HO-PEG3-CH2COOH 51951-05-4
Not For Human Use, Lab Use Only.
HO-PEG3-CH2COOH 51951-05-4
Bulk purchasing
Send email to vip@kirklandpeptide.com to get VIP discount!
| Product Name | HO-PEG3-CH2COOH | |
|---|---|---|
| Synonyms | PEG3-O-CH2COOH Hydroxy-PEG3-CH2COOH PROTAC Linker 8 |
|
| Cas No. | 51951-05-4 | |
| Purity | 98.00% | |
| Properties State | Liquid | |
| Molecular Weight | 208.21 | |
| Molecular Formula | C8H16O6 | |
| IUPAC Name | 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]acetic acid | |
| InChI | InChI=1S/C8H16O6/c9-1-2-12-3-4-13-5-6-14-7-8(10)11/h9H,1-7H2,(H,10,11) | |
| InChIKey | NUAYEVLSVMOUPE-UHFFFAOYSA-N | |
| Canonical SMILES | C(COCCOCCOCC(=O)O)O | |
| CBNumber | CB63340561 | |
| Storage Condition | store at under-20 ℃ | |
Categories: Protac Linkers