H2N-PEG3-CH2COOtBu 189808-70-6
Not For Human Use, Lab Use Only.
H2N-PEG3-CH2COOtBu 189808-70-6
Bulk purchasing
Send email to vip@kirklandpeptide.com to get VIP discount!
| Product Name | H2N-PEG3-CH2COOtBu | |
| Synonyms | Amino-PEG3-CH2CO2-t-butyl ester NH2-PEG3-C1-Boc tert-butyl 2-(2-(2-(2-aminoethoxy)ethoxy)ethoxy)acetate |
|
| Cas No. | 189808-70-6 | |
| Purity | 98.00% | |
| Properties State | Liquid | |
| Molecular Weight | 263.33 | |
| Molecular Formula | C12H25NO5 | |
| IUPAC Name | tert-butyl 2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]acetate | |
| InChI | InChI=1S/C12H25NO5/c1-12(2,3)18-11(14)10-17-9-8-16-7-6-15-5-4-13/h4-10,13H2,1-3H3 | |
| InChIKey | OTTHWLFOQWLZKB-UHFFFAOYSA-N | |
| Canonical SMILES | CC(C)(C)OC(=O)COCCOCCOCCN | |
| CBNumber | CB13340571 | |
| Storage Condition | store at under-20 ℃ | |
Categories: Protac Linkers