Butanoic acid, 4-[(4-aminobutyl)amino]-4-oxo- 57530-97-9
Not For Human Use, Lab Use Only.
Butanoic acid, 4-[(4-aminobutyl)amino]-4-oxo- 57530-97-9
SKU
KLP-006-ProtacL-08
Category Protac Linkers
Tags ADC Linkers, PDC Linkers, Protac Linkers, RDC Linkers
Bulk purchasing
Send email to vip@kirklandpeptide.com to get VIP discount!
Product Name | Butanoic acid, 4-[(4-aminobutyl)amino]-4-oxo- | |
---|---|---|
Synonyms | 4-((4-Aminobutyl)amino)-4-oxobutanoic acid 57530-97-9 CS-0379928 |
|
Cas No. | 57530-97-9 | |
Purity | 98.00% | |
Properties State | Liquid | |
Molecular Weight | 188.22 | |
Molecular Formula | C8H16N2O3 | |
IUPAC Name | 4-(4-aminobutylamino)-4-oxobutanoic acid | |
InChI | InChI=1S/C8H16N2O3/c9-5-1-2-6-10-7(11)3-4-8(12)13/h1-6,9H2,(H,10,11)(H,12,13) | |
InChIKey | POVGBHBZEFNYOV-UHFFFAOYSA-N | |
Canonical SMILES | C(CCNC(=O)CCC(=O)O)CN | |
CBNumber | CB95955887 | |
Storage Condition | store at under-20 ℃ |
Categories: Protac Linkers