P-NH2-Bn-DTPA 102650-29-3
Not For Human Use, Lab Use Only.
P-NH2-Bn-DTPA 102650-29-3
Bulk purchasing
Send email to vip@kirklandpeptide.com to get VIP discount!
Product Name P-NH2-Bn-DTPA
| Synonyms | Glycine, N-[(2S)-3-(4-aminophenyl)-2-[bis(carboxymethyl)amino]propyl]-N-[2-[bis(carboxymethyl)amino]ethyl]- AKOS027337697 A852100 S-2-(4-Aminobenzyl)-diethylenetriamine pentaacetic acid TFA salt, p-NH2-Bn-DTPA-TFA (S)-2,2′-((2-((3-(4-aminophenyl)-2-(bis(carboxymethyl)amino)propyl)(carboxymethyl)amino)ethyl)azanediyl)diacetic acid |
|
| Cas No. | 102650-29-3 | |
| Purity | 98.00% | |
| Properties State | White to off-white powder | |
| Molecular Weight | 644.30 | |
| Molecular Formula | C21H30N4O10.4HCl | |
| IUPAC Name | 2-[[(2S)-3-(4-aminophenyl)-2-[bis(carboxymethyl)amino]propyl]-[2-[bis(carboxymethyl)amino]ethyl]amino]acetic acid | |
| InChI | InChI=1S/C21H30N4O10/c22-15-3-1-14(2-4-15)7-16(25(12-20(32)33)13-21(34)35)8-23(9-17(26)27)5-6-24(10-18(28)29) 11-19(30)31/h1-4,16H,5-13,22H2,(H,26,27)(H,28,29)(H,30,31)(H,32,33)(H,34,35)/t16-/m0/s1 |
|
| InChIKey | FEZWPBDUNJUSES-INIZCTEOSA-N | |
| Canonical SMILES | C1=CC(=CC=C1CC(CN(CCN(CC(=O)O)CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O)N | |
| CBNumber | CB82561026 | |
| Storage Condition | store at under-20 ℃ | |
Categories: PDC Linkers