P-NH2-Bn-CHX-A”-DTPA 1105741-38-5
Not For Human Use, Lab Use Only.
P-NH2-Bn-CHX-A”-DTPA 1105741-38-5
Bulk purchasing
Send email to vip@kirklandpeptide.com to get VIP discount!
Product Name P-NH2-Bn-CHX-A”-DTPA
| Synonyms | p-NH2-CHX-A”-DTPA SCHEMBL10063839 HY-148646 CS-0646583 1105741-38-5 2,2′-(((1S,2S)-2-(((R)-3-(4-Aminophenyl)-2-(bis(carboxymethyl)amino)propyl)(carboxymethyl)amino)cyclohexyl)azanediyl)diacetic acid |
|
| Cas No. | 1105741-38-5 | |
| Purity | 98.00% | |
| Properties State | White to off-white powder | |
| Molecular Weight | 661.50 | |
| Molecular Formula | C25H36N4O10.2HCl.2H2O | |
| IUPAC Name | 2-[[(2R)-3-(4-aminophenyl)-2-[bis(carboxymethyl)amino]propyl]-[(1S,2S)-2-[bis(carboxymethyl)amino]cyclohexyl]amino]acetic acid | |
| InChI | InChI=1S/C25H36N4O10/c26-17-7-5-16(6-8-17)9-18(27(11-21(30)31)12-22(32)33)10-28(13-23(34)35)19-3-1-2-4-20(19)29(14-24(36)37)15-25(38)39/h5-8,18-20H,1-4,9-15,26H2,(H,30,31)(H,32,33)(H,34,35)(H,36,37)(H,38,39)/t18-,19+,20+/m1/s1 | |
| InChIKey | VFIMOMHTMFXXPG-AABGKKOBSA-N | |
| Canonical SMILES | C1CCC(C(C1)N(CC(CC2=CC=C(C=C2)N)N(CC(=O)O)CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O | |
| CBNumber | CB95963679 | |
| Storage Condition | store at under-20 ℃ | |
Categories: PDC Linkers