DTPA-tetra(t-Bu ester) 174267-71-1
Not For Human Use, Lab Use Only.
DTPA-tetra(t-Bu ester) 174267-71-1
Bulk purchasing
Send email to vip@kirklandpeptide.com to get VIP discount!
Product Name DTPA-tetra(t-Bu ester)
| Synonyms | 2-(Bis(2-(bis(2-(tert-butoxy)-2-oxoethyl)amino)ethyl)amino)acetic acid DTPA-TETRA T-BUTYL ESTER (B-365) 12-Oxa-3,6,9-triazatetradecanoic acid, 6-(carboxymethyl)-3,9-bis[2-(1,1-dimethylethoxy)-2-oxoethyl]-13,13-dimethyl-11-oxo-, 1-(1,1-dimethylethyl) ester 2-[bis[2-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]ethyl]amino]acetic acid |
|
| Cas No. | 174267-71-1 | |
| Purity | 98.00% | |
| Properties State | White to off-white powder | |
| Molecular Weight | 617.80 | |
| Molecular Formula | C30H55N3O10 | |
| IUPAC Name | 2-[bis[2-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]ethyl]amino]acetic acid | |
| InChI | InChI=1S/C30H55N3O10/c1-27(2,3)40-23(36)18-32(19-24(37)41-28(4,5)6)15-13-31(17-22(34)35)14-16-33(20-25(38)42-29(7,8)9)21-26(39)43-30(10,11)12/h13-21H2,1-12H3,(H,34,35) | |
| InChIKey | YOAXKQZNUYOPFL-UHFFFAOYSA-N | |
| Canonical SMILES | CC(C)(C)OC(=O)CN(CCN(CCN(CC(=O)OC(C)(C)C)CC(=O)OC(C)(C)C)CC(=O)O)CC(=O)OC(C)(C)C | |
| CBNumber | CB62561017 | |
| Storage Condition | store at under-20 ℃ | |
Categories: PDC Linkers