DOTA-tris(t-Bu ester) 137076-54-1
Not For Human Use, Lab Use Only.
DOTA-tris(t-Bu ester) 137076-54-1
Bulk purchasing
Send email to vip@kirklandpeptide.com to get VIP discount!
Product Name DOTA-tris(t-Bu ester)
| Synonyms | Tri-tert-butyl 1,4,7,10-tetraazacyclododecane-1,4,7,10-tetraacetate 2-(4,7,10-Tris(2-(tert-butoxy)-2-oxoethyl)-1,4,7,10-tetraazacyclododecan-1-yl)acetic acid DOTA-tri(t-butyl ester) TRI-TERT-BUTYL 1 4 7 10-TETRAAZACYCLODOD |
|
| Cas No. | 137076-54-1 | |
| Purity | 98.00% | |
| Properties State | White to off-white powder | |
| Molecular Weight | 572.70 | |
| Molecular Formula | C28H52N4O8 | |
| IUPAC Name | 2-[4,7,10-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid | |
| InChI | InChI=1S/C28H52N4O8/c1-26(2,3)38-23(35)19-30-12-10-29(18-22(33)34)11-13-31(20-24(36)39-27(4,5)6)15-17-32(16-14-30)21-25(37)40-28(7,8)9/h10-21H2,1-9H3,(H,33,34) | |
| InChIKey | RVUXZXMKYMSWOM-UHFFFAOYSA-N | |
| Canonical SMILES | CC(C)(C)OC(=O)CN1CCN(CCN(CCN(CC1)CC(=O)OC(C)(C)C)CC(=O)OC(C)(C)C)CC(=O)O | |
| CBNumber | CB1497261 | |
| Storage Condition | store at under-20 ℃ | |
Categories: PDC Linkers