Amino-PEG3-CH2CO2H 134978-99-7
Not For Human Use, Lab Use Only.
Amino-PEG3-CH2CO2H 134978-99-7
Bulk purchasing
Send email to vip@kirklandpeptide.com to get VIP discount!
| Product Name | Amino-PEG3-CH2CO2H | |
| Synonyms | Amino-PEG3-CH2COOH H2N-PEG3-CH2COOH 2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]acetic acid |
|
| Cas No. | 134978-99-7 | |
| Purity | 98.00% | |
| Properties State | Liquid | |
| Molecular Weight | 207.22 | |
| Molecular Formula | C8H17NO5 | |
| IUPAC Name | 2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]acetic acid | |
| InChI | InChI=1S/C8H17NO5/c9-1-2-12-3-4-13-5-6-14-7-8(10)11/h1-7,9H2,(H,10,11) | |
| InChIKey | DGRJZSGHEKZYHP-UHFFFAOYSA-N | |
| Canonical SMILES | C(COCCOCCOCC(=O)O)N | |
| CBNumber | CB83284490 | |
| Storage Condition | store at under-20 | |
Categories: Protac Linkers