Val-Cit-PAB 159857-79-1
Not For Human Use, Lab Use Only.
Val-Cit-PAB 159857-79-1
Bulk purchasing
Send email to vip@kirklandpeptide.com to get VIP discount!
Product Name Val-Cit-PAB
| Synonyms | L-Ornithinamide, L-valyl-N5-(aminocarbonyl)-N-[4-(hydroxymethyl)phenyl]- (S)-2-((S)-2-amino-3-methylbutanamido)-N-(4-(hydroxymethyl)phenyl)-5-ureidopentanamide |
|
| Cas No. | 159857-79-1 | |
| Purity | 98.00% | |
| Properties State | White to off-white powder | |
| Molecular Weight | 379.45 | |
| Molecular Formula | C18H29N5O4 | |
| IUPAC Name | (2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-5-(carbamoylamino)-N-[4-(hydroxymethyl)phenyl]pentanamide | |
| InChI | InChI=1S/C18H29N5O4/c1-11(2)15(19)17(26)23-14(4-3-9-21-18(20)27)16(25)22-13-7-5-12(10-24)6-8-13/h5-8,11,14-15,24H,3-4,9-10,19H2,1-2H3,(H,22,25)(H,23,26)(H3,20,21,27)/t14-,15-/m0/s1 | |
| InChIKey | VEGGTWZUZGZKHY-GJZGRUSLSA-N | |
| Canonical SMILES | CC(C)C(C(=O)NC(CCCNC(=O)N)C(=O)NC1=CC=C(C=C1)CO)N | |
| CBNumber | CB92715206 | |
| Storage Condition | store at under-20 ℃ | |
Categories: ADC Linkers