Gly-Gly-Phe-Gly-NH-CH2-O-CH2COOH 1599440-20-6
Not For Human Use, Lab Use Only.
Gly-Gly-Phe-Gly-NH-CH2-O-CH2COOH 1599440-20-6
Bulk purchasing
Send email to vip@kirklandpeptide.com to get VIP discount!
Product Name Gly-Gly-Phe-Gly-NH-CH2-O-CH2COOH
| Synonyms | Gly-Gly-Phe-Gly-NH-CH2-O-CH2COOH (S)-16-Amino-10-benzyl-6,9,12,15-tetraoxo-3-oxa-5,8,11,14-tetraazahexadecan-1-oic acid (S)-16-amino-10-benzyl-6,9,12,15-tetraoxo-3-oxa-5,8,11,14-tetraazahexadecanoic Acid |
|
| Cas No. | 1599440-20-6 | |
| Purity | 98.00% | |
| Properties State | White to off-white powder | |
| Molecular Weight | 423.43 | |
| Molecular Formula | C18H25N5O7 | |
| IUPAC Name | 2-[[[2-[[(2S)-2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3-phenylpropanoyl]amino]acetyl]amino]methoxy]acetic acid | |
| InChI | InChI=1S/C18H25N5O7/c19-7-14(24)20-9-16(26)23-13(6-12-4-2-1-3-5-12)18(29)21-8-15(25)22-11-30-10-17(27)28/h1-5,13H,6-11,19H2,(H,20,24)(H,21,29)(H,22,25)(H,23,26)(H,27,28)/t13-/m0/s1 | |
| InChIKey | JKVPATHZQGMASP-ZDUSSCGKSA-N | |
| Canonical SMILES | C1=CC=C(C=C1)CC(C(=O)NCC(=O)NCOCC(=O)O)NC(=O)CNC(=O)CN | |
| CBNumber | CB88218654 | |
| Storage Condition | store at under-20 ℃ | |
Categories: ADC Linkers