N-[4-(-Carboxycyclohexylmethyl)]maleimide 64987-82-2
Not For Human Use, Lab Use Only.
N-[4-(-Carboxycyclohexylmethyl)]maleimide 64987-82-2
Bulk purchasing
Send email to vip@kirklandpeptide.com to get VIP discount!
Product Name N-[4-(-Carboxycyclohexylmethyl)]maleimide
| Synonyms | TRANS-4-(MALEIMIDOMETHYL)CYCLOHEXANECARBOXYLIC ACID trans-4-((2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)methyl)cyclohexanecarboxylic acid N-[4-(-Carboxycyclohexylmethyl)]maleimide |
|
| Cas No. | 64987-82-2 | |
| Purity | 98.00% | |
| Properties State | White to off-white powder | |
| Molecular Weight | 237.25 | |
| Molecular Formula | C12H15NO4 | |
| IUPAC Name | 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylic acid | |
| InChI | InChI=1S/C12H15NO4/c14-10-5-6-11(15)13(10)7-8-1-3-9(4-2-8)12(16)17/h5-6,8-9H,1-4,7H2,(H,16,17) | |
| InChIKey | LQILVUYCDHSGEU-UHFFFAOYSA-N | |
| Canonical SMILES | C1CC(CCC1CN2C(=O)C=CC2=O)C(=O)O | |
| CBNumber | CB41176520 | |
| Storage Condition | store at under-20 ℃ | |
Categories: ADC Linkers